About 2-(4-amino-1,2,4-triazol-4-ium-1-yl)ethanol
2-(4-amino-1,2,4-triazol-4-ium-1-yl)ethanol (PubChem CID 67001198) has the molecular formula C4H9N4O+
and a molecular weight of 129.14 g/mol. Its IUPAC name is 2-(4-amino-1,2,4-triazol-4-ium-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(4-amino-1,2,4-triazol-4-ium-1-yl)ethanol |
| PubChem CID | 67001198 |
| Molecular Formula | C4H9N4O+ |
| Molecular Weight | 129.14 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 2-(4-amino-1,2,4-triazol-4-ium-1-yl)ethanol |
| SMILES | N[n+]1cnn(CCO)c1 |
| InChI | InChI=1S/C4H9N4O/c5-7-3-6-8(4-7)1-2-9/h3-4,9H,1-2,5H2/q+1 |
| InChIKey | DEXIPUCLKAZJPV-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.14 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-amino-1,2,4-triazol-4-ium-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-1,2,4-triazol-4-ium-1-yl)ethanol?
The IUPAC name of 2-(4-amino-1,2,4-triazol-4-ium-1-yl)ethanol (CID 67001198) is 2-(4-amino-1,2,4-triazol-4-ium-1-yl)ethanol.
What is the SMILES notation for 2-(4-amino-1,2,4-triazol-4-ium-1-yl)ethanol?
The canonical SMILES for 2-(4-amino-1,2,4-triazol-4-ium-1-yl)ethanol is N[n+]1cnn(CCO)c1.
What is the InChIKey of 2-(4-amino-1,2,4-triazol-4-ium-1-yl)ethanol?
The InChIKey is DEXIPUCLKAZJPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N4O/c5-7-3-6-8(4-7)1-2-9/h3-4,9H,1-2,5H2/q+1.
What are the key properties of 2-(4-amino-1,2,4-triazol-4-ium-1-yl)ethanol?
2-(4-amino-1,2,4-triazol-4-ium-1-yl)ethanol has a molecular weight of 129.14 g/mol, XLogP of -2.12, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-1,2,4-triazol-4-ium-1-yl)ethanol is sourced from PubChem (CID 67001198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).