C33H22F3N3O2 — CID 67001372
[amino-[4-(5-naphthalen-2-yl-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl] 2,2,2-trifluoroacetate (PubChem CID 67001372) has the molecular formula C33H22F3N3O2 and a molecular weight of 549.55 g/mol. Its IUPAC name is [amino-[4-(5-naphthalen-2-yl-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl] 2,2,2-trifluoroacetate.
| Compound Name | [amino-[4-(5-naphthalen-2-yl-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67001372 |
| Molecular Formula | C33H22F3N3O2 |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | [amino-[4-(5-naphthalen-2-yl-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl] 2,2,2-trifluoroacetate |
| SMILES | NC(OC(=O)C(F)(F)F)c1ccc(-c2nc3ccnc(-c4ccc5ccccc5c4)c3cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H22F3N3O2/c34-33(35,36)32(40)41-31(37)23-13-11-22(12-14-23)30-26(21-7-2-1-3-8-21)19-27-28(39-30)16-17-38-29(27)25-15-10-20-6-4-5-9-24(20)18-25/h1-19,31H,37H2 |
| InChIKey | JXYNELVRUCHUEZ-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|