C26H28FIN4O6 — CID 67001563
5-[4-(2,3-dihydroxypropoxy)phenyl]-3-[(1R,2R)-1-[4-(2-fluoro-4-iodophenyl)-5-methyl-1H-imidazol-2-yl]-2-methoxypropyl]imidazolidine-2,4-dione (PubChem CID 67001563) has the molecular formula C26H28FIN4O6 and a molecular weight of 638.43 g/mol. Its IUPAC name is 5-[4-(2,3-dihydroxypropoxy)phenyl]-3-[(1R,2R)-1-[4-(2-fluoro-4-iodophenyl)-5-methyl-1H-imidazol-2-yl]-2-methoxypropyl]imidazolidine-2,4-dione.
| Compound Name | 5-[4-(2,3-dihydroxypropoxy)phenyl]-3-[(1R,2R)-1-[4-(2-fluoro-4-iodophenyl)-5-methyl-1H-imidazol-2-yl]-2-methoxypropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 67001563 |
| Molecular Formula | C26H28FIN4O6 |
| Molecular Weight | 638.43 g/mol |
| Exact Mass | 638.10 |
| IUPAC Name | 5-[4-(2,3-dihydroxypropoxy)phenyl]-3-[(1R,2R)-1-[4-(2-fluoro-4-iodophenyl)-5-methyl-1H-imidazol-2-yl]-2-methoxypropyl]imidazolidine-2,4-dione |
| SMILES | CO[C@H](C)[C@@H](c1nc(-c2ccc(I)cc2F)c(C)[nH]1)N1C(=O)NC(c2ccc(OCC(O)CO)cc2)C1=O |
| InChI | InChI=1S/C26H28FIN4O6/c1-13-21(19-9-6-16(28)10-20(19)27)30-24(29-13)23(14(2)37-3)32-25(35)22(31-26(32)36)15-4-7-18(8-5-15)38-12-17(34)11-33/h4-10,14,17,22-23,33-34H,11-12H2,1-3H3,(H,29,30)(H,31,36)/t14-,17?,22?,23+/m1/s1 |
| InChIKey | UJUVVBRJNMYXOF-LGWHRCMSSA-N |
| XLogP | 3.23 |
| TPSA | 137.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|