C23H27ClN4O2 — CID 67001638
[3-(4-chlorophenyl)-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepin-6-yl]-morpholin-4-ylmethanone (PubChem CID 67001638) has the molecular formula C23H27ClN4O2 and a molecular weight of 426.95 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepin-6-yl]-morpholin-4-ylmethanone.
| Compound Name | [3-(4-chlorophenyl)-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepin-6-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 67001638 |
| Molecular Formula | C23H27ClN4O2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | [3-(4-chlorophenyl)-1,2,4,4a,5,7-hexahydropyrazino[1,2-a][1,4]benzodiazepin-6-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(N1CCOCC1)N1Cc2ccccc2N2CCN(c3ccc(Cl)cc3)CC2C1 |
| InChI | InChI=1S/C23H27ClN4O2/c24-19-5-7-20(8-6-19)26-9-10-28-21(16-26)17-27(15-18-3-1-2-4-22(18)28)23(29)25-11-13-30-14-12-25/h1-8,21H,9-17H2 |
| InChIKey | PTZVTUKMAHJBFN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |