C25H18F3N7O2 — CID 67001788
[amino-[4-[6-(5-methyl-1H-1,2,4-triazol-3-yl)-2-phenylpyrido[2,3-b]pyrazin-3-yl]phenyl]methyl] 2,2,2-trifluoroacetate (PubChem CID 67001788) has the molecular formula C25H18F3N7O2 and a molecular weight of 505.46 g/mol. Its IUPAC name is [amino-[4-[6-(5-methyl-1H-1,2,4-triazol-3-yl)-2-phenylpyrido[2,3-b]pyrazin-3-yl]phenyl]methyl] 2,2,2-trifluoroacetate.
| Compound Name | [amino-[4-[6-(5-methyl-1H-1,2,4-triazol-3-yl)-2-phenylpyrido[2,3-b]pyrazin-3-yl]phenyl]methyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67001788 |
| Molecular Formula | C25H18F3N7O2 |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | [amino-[4-[6-(5-methyl-1H-1,2,4-triazol-3-yl)-2-phenylpyrido[2,3-b]pyrazin-3-yl]phenyl]methyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1nc(-c2ccc3nc(-c4ccccc4)c(-c4ccc(C(N)OC(=O)C(F)(F)F)cc4)nc3n2)n[nH]1 |
| InChI | InChI=1S/C25H18F3N7O2/c1-13-30-23(35-34-13)18-12-11-17-22(32-18)33-20(19(31-17)14-5-3-2-4-6-14)15-7-9-16(10-8-15)21(29)37-24(36)25(26,27)28/h2-12,21H,29H2,1H3,(H,30,34,35) |
| InChIKey | DXXTTWIVUYEMLK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 132.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|