C27H36FN5O2 — CID 67002042
(2S)-2-tert-butyl-2-[[13-[(4-fluorophenyl)methyl]-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-8-yl]methyl]azetidine-1-carboxylic acid (PubChem CID 67002042) has the molecular formula C27H36FN5O2 and a molecular weight of 481.62 g/mol. Its IUPAC name is (2S)-2-tert-butyl-2-[[13-[(4-fluorophenyl)methyl]-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-8-yl]methyl]azetidine-1-carboxylic acid.
| Compound Name | (2S)-2-tert-butyl-2-[[13-[(4-fluorophenyl)methyl]-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-8-yl]methyl]azetidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67002042 |
| Molecular Formula | C27H36FN5O2 |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | (2S)-2-tert-butyl-2-[[13-[(4-fluorophenyl)methyl]-1,3,8,13-tetrazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-8-yl]methyl]azetidine-1-carboxylic acid |
| SMILES | CC(C)(C)[C@]1(CN2CCC3CN(Cc4ccc(F)cc4)CCN3c3ncccc32)CCN1C(=O)O |
| InChI | InChI=1S/C27H36FN5O2/c1-26(2,3)27(11-14-33(27)25(34)35)19-31-13-10-22-18-30(17-20-6-8-21(28)9-7-20)15-16-32(22)24-23(31)5-4-12-29-24/h4-9,12,22H,10-11,13-19H2,1-3H3,(H,34,35)/t22?,27-/m1/s1 |
| InChIKey | RUDOJUBGGBHFOT-RZIURPKCSA-N |
| XLogP | 4.29 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |