About 3-hexyl-4-methyl-2,5-dihydrothiophene 1,1-dioxide
3-hexyl-4-methyl-2,5-dihydrothiophene 1,1-dioxide (PubChem CID 67002063) has the molecular formula C11H20O2S
and a molecular weight of 216.35 g/mol. Its IUPAC name is 3-hexyl-4-methyl-2,5-dihydrothiophene 1,1-dioxide.
Molecular Properties
| Compound Name | 3-hexyl-4-methyl-2,5-dihydrothiophene 1,1-dioxide |
| PubChem CID | 67002063 |
| Molecular Formula | C11H20O2S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 3-hexyl-4-methyl-2,5-dihydrothiophene 1,1-dioxide |
| SMILES | CCCCCCC1=C(C)CS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20O2S/c1-3-4-5-6-7-11-9-14(12,13)8-10(11)2/h3-9H2,1-2H3 |
| InChIKey | QCUJGQSEKOVVPY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-hexyl-4-methyl-2,5-dihydrothiophene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexyl-4-methyl-2,5-dihydrothiophene 1,1-dioxide?
The IUPAC name of 3-hexyl-4-methyl-2,5-dihydrothiophene 1,1-dioxide (CID 67002063) is 3-hexyl-4-methyl-2,5-dihydrothiophene 1,1-dioxide.
What is the SMILES notation for 3-hexyl-4-methyl-2,5-dihydrothiophene 1,1-dioxide?
The canonical SMILES for 3-hexyl-4-methyl-2,5-dihydrothiophene 1,1-dioxide is CCCCCCC1=C(C)CS(=O)(=O)C1.
What is the InChIKey of 3-hexyl-4-methyl-2,5-dihydrothiophene 1,1-dioxide?
The InChIKey is QCUJGQSEKOVVPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2S/c1-3-4-5-6-7-11-9-14(12,13)8-10(11)2/h3-9H2,1-2H3.
What are the key properties of 3-hexyl-4-methyl-2,5-dihydrothiophene 1,1-dioxide?
3-hexyl-4-methyl-2,5-dihydrothiophene 1,1-dioxide has a molecular weight of 216.35 g/mol, XLogP of 2.70, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexyl-4-methyl-2,5-dihydrothiophene 1,1-dioxide is sourced from PubChem (CID 67002063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).