About 4-tert-butylcyclohexa-1,5-diene-1,4-diol
4-tert-butylcyclohexa-1,5-diene-1,4-diol (PubChem CID 67002195) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 4-tert-butylcyclohexa-1,5-diene-1,4-diol.
Molecular Properties
| Compound Name | 4-tert-butylcyclohexa-1,5-diene-1,4-diol |
| PubChem CID | 67002195 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 4-tert-butylcyclohexa-1,5-diene-1,4-diol |
| SMILES | CC(C)(C)C1(O)C=CC(O)=CC1 |
| InChI | InChI=1S/C10H16O2/c1-9(2,3)10(12)6-4-8(11)5-7-10/h4-6,11-12H,7H2,1-3H3 |
| InChIKey | PMYYGAMMFAQAGL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butylcyclohexa-1,5-diene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butylcyclohexa-1,5-diene-1,4-diol?
The IUPAC name of 4-tert-butylcyclohexa-1,5-diene-1,4-diol (CID 67002195) is 4-tert-butylcyclohexa-1,5-diene-1,4-diol.
What is the SMILES notation for 4-tert-butylcyclohexa-1,5-diene-1,4-diol?
The canonical SMILES for 4-tert-butylcyclohexa-1,5-diene-1,4-diol is CC(C)(C)C1(O)C=CC(O)=CC1.
What is the InChIKey of 4-tert-butylcyclohexa-1,5-diene-1,4-diol?
The InChIKey is PMYYGAMMFAQAGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-9(2,3)10(12)6-4-8(11)5-7-10/h4-6,11-12H,7H2,1-3H3.
What are the key properties of 4-tert-butylcyclohexa-1,5-diene-1,4-diol?
4-tert-butylcyclohexa-1,5-diene-1,4-diol has a molecular weight of 168.24 g/mol, XLogP of 2.17, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butylcyclohexa-1,5-diene-1,4-diol is sourced from PubChem (CID 67002195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).