About 1-bromo-3,5-dihexylbenzene
1-bromo-3,5-dihexylbenzene (PubChem CID 67002258) has the molecular formula C18H29Br
and a molecular weight of 325.33 g/mol. Its IUPAC name is 1-bromo-3,5-dihexylbenzene.
Molecular Properties
| Compound Name | 1-bromo-3,5-dihexylbenzene |
| PubChem CID | 67002258 |
| Molecular Formula | C18H29Br |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-bromo-3,5-dihexylbenzene |
| SMILES | CCCCCCc1cc(Br)cc(CCCCCC)c1 |
| InChI | InChI=1S/C18H29Br/c1-3-5-7-9-11-16-13-17(15-18(19)14-16)12-10-8-6-4-2/h13-15H,3-12H2,1-2H3 |
| InChIKey | FVTKYSBFHHVYJG-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3,5-dihexylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3,5-dihexylbenzene?
The IUPAC name of 1-bromo-3,5-dihexylbenzene (CID 67002258) is 1-bromo-3,5-dihexylbenzene.
What is the SMILES notation for 1-bromo-3,5-dihexylbenzene?
The canonical SMILES for 1-bromo-3,5-dihexylbenzene is CCCCCCc1cc(Br)cc(CCCCCC)c1.
What is the InChIKey of 1-bromo-3,5-dihexylbenzene?
The InChIKey is FVTKYSBFHHVYJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29Br/c1-3-5-7-9-11-16-13-17(15-18(19)14-16)12-10-8-6-4-2/h13-15H,3-12H2,1-2H3.
What are the key properties of 1-bromo-3,5-dihexylbenzene?
1-bromo-3,5-dihexylbenzene has a molecular weight of 325.33 g/mol, XLogP of 6.69, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3,5-dihexylbenzene is sourced from PubChem (CID 67002258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).