C25H34N4O3Si — CID 67002498
N-cyclohexyl-2-phenoxy-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 67002498) has the molecular formula C25H34N4O3Si and a molecular weight of 466.66 g/mol. Its IUPAC name is N-cyclohexyl-2-phenoxy-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-cyclohexyl-2-phenoxy-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 67002498 |
| Molecular Formula | C25H34N4O3Si |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | N-cyclohexyl-2-phenoxy-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1cc(C(=O)NC2CCCCC2)c2nc(Oc3ccccc3)cnc21 |
| InChI | InChI=1S/C25H34N4O3Si/c1-33(2,3)15-14-31-18-29-17-21(25(30)27-19-10-6-4-7-11-19)23-24(29)26-16-22(28-23)32-20-12-8-5-9-13-20/h5,8-9,12-13,16-17,19H,4,6-7,10-11,14-15,18H2,1-3H3,(H,27,30) |
| InChIKey | MKLIPYJRAAPYIZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|