4-(imidazo[1,2-a]pyridine-3-carbonyl)benzoic acid

C15H10N2O3 — CID 67003128

IUPAC4-(imidazo[1,2-a]pyridine-3-carbonyl)benzoic acid
SMILESO=C(O)c1ccc(C(=O)c2cnc3ccccn23)cc1
InChIInChI=1S/C15H10N2O3/c18-14(10-4-6-11(7-5-10)15(19)20)12-9-16-13-3-1-2-8-17(12)13/h1-9H,(H,19,20)
InChIKeyLHSLZTQFBIGOQO-UHFFFAOYSA-N
MW266.26 g/mol
LogP2.26
Rot. Bonds3

About 4-(imidazo[1,2-a]pyridine-3-carbonyl)benzoic acid

4-(imidazo[1,2-a]pyridine-3-carbonyl)benzoic acid (PubChem CID 67003128) has the molecular formula C15H10N2O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 4-(imidazo[1,2-a]pyridine-3-carbonyl)benzoic acid.

Molecular Properties

Compound Name4-(imidazo[1,2-a]pyridine-3-carbonyl)benzoic acid
PubChem CID67003128
Molecular FormulaC15H10N2O3
Molecular Weight266.26 g/mol
Exact Mass266.07
IUPAC Name4-(imidazo[1,2-a]pyridine-3-carbonyl)benzoic acid
SMILESO=C(O)c1ccc(C(=O)c2cnc3ccccn23)cc1
InChIInChI=1S/C15H10N2O3/c18-14(10-4-6-11(7-5-10)15(19)20)12-9-16-13-3-1-2-8-17(12)13/h1-9H,(H,19,20)
InChIKeyLHSLZTQFBIGOQO-UHFFFAOYSA-N
XLogP2.26
TPSA71.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.26
LogP ≤ 52.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(imidazo[1,2-a]pyridine-3-carbonyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(imidazo[1,2-a]pyridine-3-carbonyl)benzoic acid?
The IUPAC name of 4-(imidazo[1,2-a]pyridine-3-carbonyl)benzoic acid (CID 67003128) is 4-(imidazo[1,2-a]pyridine-3-carbonyl)benzoic acid.
What is the SMILES notation for 4-(imidazo[1,2-a]pyridine-3-carbonyl)benzoic acid?
The canonical SMILES for 4-(imidazo[1,2-a]pyridine-3-carbonyl)benzoic acid is O=C(O)c1ccc(C(=O)c2cnc3ccccn23)cc1.
What is the InChIKey of 4-(imidazo[1,2-a]pyridine-3-carbonyl)benzoic acid?
The InChIKey is LHSLZTQFBIGOQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O3/c18-14(10-4-6-11(7-5-10)15(19)20)12-9-16-13-3-1-2-8-17(12)13/h1-9H,(H,19,20).
What are the key properties of 4-(imidazo[1,2-a]pyridine-3-carbonyl)benzoic acid?
4-(imidazo[1,2-a]pyridine-3-carbonyl)benzoic acid has a molecular weight of 266.26 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(imidazo[1,2-a]pyridine-3-carbonyl)benzoic acid is sourced from PubChem (CID 67003128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).