C29H26ClFN4O4S2 — CID 67003458
4-[5-chloro-4-[2-[1-(methoxymethoxy)cyclobutyl]-1,3-thiazol-5-yl]-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]-2-fluoroaniline (PubChem CID 67003458) has the molecular formula C29H26ClFN4O4S2 and a molecular weight of 613.14 g/mol. Its IUPAC name is 4-[5-chloro-4-[2-[1-(methoxymethoxy)cyclobutyl]-1,3-thiazol-5-yl]-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]-2-fluoroaniline.
| Compound Name | 4-[5-chloro-4-[2-[1-(methoxymethoxy)cyclobutyl]-1,3-thiazol-5-yl]-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]-2-fluoroaniline |
|---|---|
| PubChem CID | 67003458 |
| Molecular Formula | C29H26ClFN4O4S2 |
| Molecular Weight | 613.14 g/mol |
| Exact Mass | 612.11 |
| IUPAC Name | 4-[5-chloro-4-[2-[1-(methoxymethoxy)cyclobutyl]-1,3-thiazol-5-yl]-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]-2-fluoroaniline |
| SMILES | COCOC1(c2ncc(-c3c(Cl)cnc4c3cc(-c3ccc(N)c(F)c3)n4S(=O)(=O)c3ccc(C)cc3)s2)CCC1 |
| InChI | InChI=1S/C29H26ClFN4O4S2/c1-17-4-7-19(8-5-17)41(36,37)35-24(18-6-9-23(32)22(31)12-18)13-20-26(21(30)14-33-27(20)35)25-15-34-28(40-25)29(10-3-11-29)39-16-38-2/h4-9,12-15H,3,10-11,16,32H2,1-2H3 |
| InChIKey | UMCQSRYHQFOPNM-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.14 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|