C15H22O6 — CID 67003771
bis(1-methoxyethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 67003771) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is bis(1-methoxyethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis(1-methoxyethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 67003771 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | bis(1-methoxyethyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | COC(C)OC(=O)C1C2C=CC(C2)C1C(=O)OC(C)OC |
| InChI | InChI=1S/C15H22O6/c1-8(18-3)20-14(16)12-10-5-6-11(7-10)13(12)15(17)21-9(2)19-4/h5-6,8-13H,7H2,1-4H3 |
| InChIKey | LSYHMIKGOQNXHZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|