C10H12N2O2 — CID 67004024
2-prop-2-enyl-6,7-dihydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 67004024) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-prop-2-enyl-6,7-dihydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | 2-prop-2-enyl-6,7-dihydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 67004024 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-prop-2-enyl-6,7-dihydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | C=CCN1CC(=O)N2CCC=C2C1=O |
| InChI | InChI=1S/C10H12N2O2/c1-2-5-11-7-9(13)12-6-3-4-8(12)10(11)14/h2,4H,1,3,5-7H2 |
| InChIKey | BZTGGPLNLMFSBU-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|