About 6-hydroxy-7,8-dihydrobenzo[c][1,2]benzoxaphosphinine
6-hydroxy-7,8-dihydrobenzo[c][1,2]benzoxaphosphinine (PubChem CID 67004309) has the molecular formula C12H11O2P
and a molecular weight of 218.19 g/mol. Its IUPAC name is 6-hydroxy-7,8-dihydrobenzo[c][1,2]benzoxaphosphinine.
Molecular Properties
| Compound Name | 6-hydroxy-7,8-dihydrobenzo[c][1,2]benzoxaphosphinine |
| PubChem CID | 67004309 |
| Molecular Formula | C12H11O2P |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 6-hydroxy-7,8-dihydrobenzo[c][1,2]benzoxaphosphinine |
| SMILES | OP1Oc2ccccc2C2=C1CCC=C2 |
| InChI | InChI=1S/C12H11O2P/c13-15-12-8-4-2-6-10(12)9-5-1-3-7-11(9)14-15/h1-3,5-7,13H,4,8H2 |
| InChIKey | OLADITVWXAGHJV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-7,8-dihydrobenzo[c][1,2]benzoxaphosphinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-7,8-dihydrobenzo[c][1,2]benzoxaphosphinine?
The IUPAC name of 6-hydroxy-7,8-dihydrobenzo[c][1,2]benzoxaphosphinine (CID 67004309) is 6-hydroxy-7,8-dihydrobenzo[c][1,2]benzoxaphosphinine.
What is the SMILES notation for 6-hydroxy-7,8-dihydrobenzo[c][1,2]benzoxaphosphinine?
The canonical SMILES for 6-hydroxy-7,8-dihydrobenzo[c][1,2]benzoxaphosphinine is OP1Oc2ccccc2C2=C1CCC=C2.
What is the InChIKey of 6-hydroxy-7,8-dihydrobenzo[c][1,2]benzoxaphosphinine?
The InChIKey is OLADITVWXAGHJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11O2P/c13-15-12-8-4-2-6-10(12)9-5-1-3-7-11(9)14-15/h1-3,5-7,13H,4,8H2.
What are the key properties of 6-hydroxy-7,8-dihydrobenzo[c][1,2]benzoxaphosphinine?
6-hydroxy-7,8-dihydrobenzo[c][1,2]benzoxaphosphinine has a molecular weight of 218.19 g/mol, XLogP of 3.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-7,8-dihydrobenzo[c][1,2]benzoxaphosphinine is sourced from PubChem (CID 67004309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).