C17H15FN2O2 — CID 67005212
3-[1-(4-fluorophenyl)-6-methylindazol-5-yl]propanoic acid (PubChem CID 67005212) has the molecular formula C17H15FN2O2 and a molecular weight of 298.32 g/mol. Its IUPAC name is 3-[1-(4-fluorophenyl)-6-methylindazol-5-yl]propanoic acid.
| Compound Name | 3-[1-(4-fluorophenyl)-6-methylindazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 67005212 |
| Molecular Formula | C17H15FN2O2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-[1-(4-fluorophenyl)-6-methylindazol-5-yl]propanoic acid |
| SMILES | Cc1cc2c(cnn2-c2ccc(F)cc2)cc1CCC(=O)O |
| InChI | InChI=1S/C17H15FN2O2/c1-11-8-16-13(9-12(11)2-7-17(21)22)10-19-20(16)15-5-3-14(18)4-6-15/h3-6,8-10H,2,7H2,1H3,(H,21,22) |
| InChIKey | WUWYLZLBSBAWJH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |