C36H36N8O2S — CID 67005253
N-[4-(dimethylamino)butyl]-3-[[4-[6-[3-[(2-phenylacetyl)amino]phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]benzamide (PubChem CID 67005253) has the molecular formula C36H36N8O2S and a molecular weight of 644.81 g/mol. Its IUPAC name is N-[4-(dimethylamino)butyl]-3-[[4-[6-[3-[(2-phenylacetyl)amino]phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]benzamide.
| Compound Name | N-[4-(dimethylamino)butyl]-3-[[4-[6-[3-[(2-phenylacetyl)amino]phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 67005253 |
| Molecular Formula | C36H36N8O2S |
| Molecular Weight | 644.81 g/mol |
| Exact Mass | 644.27 |
| IUPAC Name | N-[4-(dimethylamino)butyl]-3-[[4-[6-[3-[(2-phenylacetyl)amino]phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]benzamide |
| SMILES | CN(C)CCCCNC(=O)c1cccc(Nc2nccc(-c3c(-c4cccc(NC(=O)Cc5ccccc5)c4)nc4sccn34)n2)c1 |
| InChI | InChI=1S/C36H36N8O2S/c1-43(2)19-7-6-17-37-34(46)27-13-9-15-29(24-27)40-35-38-18-16-30(41-35)33-32(42-36-44(33)20-21-47-36)26-12-8-14-28(23-26)39-31(45)22-25-10-4-3-5-11-25/h3-5,8-16,18,20-21,23-24H,6-7,17,19,22H2,1-2H3,(H,37,46)(H,39,45)(H,38,40,41) |
| InChIKey | AVNXTPNIELDCMM-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.81 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|