C34H32N8O2S — CID 67005378
N-[3-[5-[2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]benzamide (PubChem CID 67005378) has the molecular formula C34H32N8O2S and a molecular weight of 616.75 g/mol. Its IUPAC name is N-[3-[5-[2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]benzamide.
| Compound Name | N-[3-[5-[2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 67005378 |
| Molecular Formula | C34H32N8O2S |
| Molecular Weight | 616.75 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | N-[3-[5-[2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2nc3sccn3c2-c2ccnc(Nc3ccc(N4CCN(CCO)CC4)cc3)n2)c1)c1ccccc1 |
| InChI | InChI=1S/C34H32N8O2S/c43-21-19-40-15-17-41(18-16-40)28-11-9-26(10-12-28)37-33-35-14-13-29(38-33)31-30(39-34-42(31)20-22-45-34)25-7-4-8-27(23-25)36-32(44)24-5-2-1-3-6-24/h1-14,20,22-23,43H,15-19,21H2,(H,36,44)(H,35,37,38) |
| InChIKey | HROKOAQCUIHVCK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 110.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.75 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|