About cyclohexanamine;triethoxy(methyl)silane
cyclohexanamine;triethoxy(methyl)silane (PubChem CID 67005421) has the molecular formula C13H31NO3Si
and a molecular weight of 277.48 g/mol. Its IUPAC name is cyclohexanamine;triethoxy(methyl)silane.
Molecular Properties
| Compound Name | cyclohexanamine;triethoxy(methyl)silane |
| PubChem CID | 67005421 |
| Molecular Formula | C13H31NO3Si |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.21 |
| IUPAC Name | cyclohexanamine;triethoxy(methyl)silane |
| SMILES | CCO[Si](C)(OCC)OCC.NC1CCCCC1 |
| InChI | InChI=1S/C7H18O3Si.C6H13N/c1-5-8-11(4,9-6-2)10-7-3;7-6-4-2-1-3-5-6/h5-7H2,1-4H3;6H,1-5,7H2 |
| InChIKey | QKVKKDTVONCCGN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclohexanamine;triethoxy(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanamine;triethoxy(methyl)silane?
The IUPAC name of cyclohexanamine;triethoxy(methyl)silane (CID 67005421) is cyclohexanamine;triethoxy(methyl)silane.
What is the SMILES notation for cyclohexanamine;triethoxy(methyl)silane?
The canonical SMILES for cyclohexanamine;triethoxy(methyl)silane is CCO[Si](C)(OCC)OCC.NC1CCCCC1.
What is the InChIKey of cyclohexanamine;triethoxy(methyl)silane?
The InChIKey is QKVKKDTVONCCGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18O3Si.C6H13N/c1-5-8-11(4,9-6-2)10-7-3;7-6-4-2-1-3-5-6/h5-7H2,1-4H3;6H,1-5,7H2.
What are the key properties of cyclohexanamine;triethoxy(methyl)silane?
cyclohexanamine;triethoxy(methyl)silane has a molecular weight of 277.48 g/mol, XLogP of 2.94, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanamine;triethoxy(methyl)silane is sourced from PubChem (CID 67005421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).