C30H27N7OS2 — CID 67005478
N-(4-morpholin-4-ylphenyl)-4-[6-[3-(thiophen-2-ylmethylamino)phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine (PubChem CID 67005478) has the molecular formula C30H27N7OS2 and a molecular weight of 565.73 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-4-[6-[3-(thiophen-2-ylmethylamino)phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-4-[6-[3-(thiophen-2-ylmethylamino)phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 67005478 |
| Molecular Formula | C30H27N7OS2 |
| Molecular Weight | 565.73 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-4-[6-[3-(thiophen-2-ylmethylamino)phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine |
| SMILES | c1cc(NCc2cccs2)cc(-c2nc3sccn3c2-c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)c1 |
| InChI | InChI=1S/C30H27N7OS2/c1-3-21(19-23(4-1)32-20-25-5-2-17-39-25)27-28(37-14-18-40-30(37)35-27)26-10-11-31-29(34-26)33-22-6-8-24(9-7-22)36-12-15-38-16-13-36/h1-11,14,17-19,32H,12-13,15-16,20H2,(H,31,33,34) |
| InChIKey | DOPVPMORMFLVCE-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.73 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|