C17H26ClNO2S — CID 67005536
(2R,4aR,10aR)-2-(methylsulfanylmethyl)-4-propyl-2,3,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazin-9-ol;hydrochloride (PubChem CID 67005536) has the molecular formula C17H26ClNO2S and a molecular weight of 343.92 g/mol. Its IUPAC name is (2R,4aR,10aR)-2-(methylsulfanylmethyl)-4-propyl-2,3,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazin-9-ol;hydrochloride.
| Compound Name | (2R,4aR,10aR)-2-(methylsulfanylmethyl)-4-propyl-2,3,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazin-9-ol;hydrochloride |
|---|---|
| PubChem CID | 67005536 |
| Molecular Formula | C17H26ClNO2S |
| Molecular Weight | 343.92 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (2R,4aR,10aR)-2-(methylsulfanylmethyl)-4-propyl-2,3,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazin-9-ol;hydrochloride |
| SMILES | CCCN1C[C@H](CSC)O[C@@H]2Cc3c(O)cccc3C[C@H]21.Cl |
| InChI | InChI=1S/C17H25NO2S.ClH/c1-3-7-18-10-13(11-21-2)20-17-9-14-12(8-15(17)18)5-4-6-16(14)19;/h4-6,13,15,17,19H,3,7-11H2,1-2H3;1H/t13-,15-,17-;/m1./s1 |
| InChIKey | BBFFNLWYYFGZLA-YOLHSKTNSA-N |
| XLogP | 3.12 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.92 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |