C33H31N7O2S — CID 67005683
4-[6-[3-[(3-methoxyphenyl)methylamino]phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine (PubChem CID 67005683) has the molecular formula C33H31N7O2S and a molecular weight of 589.73 g/mol. Its IUPAC name is 4-[6-[3-[(3-methoxyphenyl)methylamino]phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine.
| Compound Name | 4-[6-[3-[(3-methoxyphenyl)methylamino]phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 67005683 |
| Molecular Formula | C33H31N7O2S |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | 4-[6-[3-[(3-methoxyphenyl)methylamino]phenyl]imidazo[2,1-b][1,3]thiazol-5-yl]-N-(4-morpholin-4-ylphenyl)pyrimidin-2-amine |
| SMILES | COc1cccc(CNc2cccc(-c3nc4sccn4c3-c3ccnc(Nc4ccc(N5CCOCC5)cc4)n3)c2)c1 |
| InChI | InChI=1S/C33H31N7O2S/c1-41-28-7-2-4-23(20-28)22-35-26-6-3-5-24(21-26)30-31(40-16-19-43-33(40)38-30)29-12-13-34-32(37-29)36-25-8-10-27(11-9-25)39-14-17-42-18-15-39/h2-13,16,19-21,35H,14-15,17-18,22H2,1H3,(H,34,36,37) |
| InChIKey | QYAJWLOQZRLCSM-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|