C33H30N8O3S — CID 67005775
1-(3-methoxyphenyl)-3-[3-[5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]urea (PubChem CID 67005775) has the molecular formula C33H30N8O3S and a molecular weight of 618.72 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-[3-[5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]urea.
| Compound Name | 1-(3-methoxyphenyl)-3-[3-[5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]urea |
|---|---|
| PubChem CID | 67005775 |
| Molecular Formula | C33H30N8O3S |
| Molecular Weight | 618.72 g/mol |
| Exact Mass | 618.22 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-[3-[5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]urea |
| SMILES | COc1cccc(NC(=O)Nc2cccc(-c3nc4sccn4c3-c3ccnc(Nc4ccc(N5CCOCC5)cc4)n3)c2)c1 |
| InChI | InChI=1S/C33H30N8O3S/c1-43-27-7-3-6-25(21-27)37-32(42)36-24-5-2-4-22(20-24)29-30(41-16-19-45-33(41)39-29)28-12-13-34-31(38-28)35-23-8-10-26(11-9-23)40-14-17-44-18-15-40/h2-13,16,19-21H,14-15,17-18H2,1H3,(H,34,35,38)(H2,36,37,42) |
| InChIKey | ZMOFXSXZPKUJOR-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.72 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|