C35H33FN8O3S — CID 67005812
1-(2-fluorophenyl)-3-[3-[5-[2-[3-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]urea (PubChem CID 67005812) has the molecular formula C35H33FN8O3S and a molecular weight of 664.77 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[3-[5-[2-[3-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[3-[5-[2-[3-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]urea |
|---|---|
| PubChem CID | 67005812 |
| Molecular Formula | C35H33FN8O3S |
| Molecular Weight | 664.77 g/mol |
| Exact Mass | 664.24 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[3-[5-[2-[3-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]urea |
| SMILES | O=C(Nc1cccc(-c2nc3sccn3c2-c2ccnc(Nc3cccc(OCCCN4CCOCC4)c3)n2)c1)Nc1ccccc1F |
| InChI | InChI=1S/C35H33FN8O3S/c36-28-10-1-2-11-29(28)41-34(45)39-25-7-3-6-24(22-25)31-32(44-17-21-48-35(44)42-31)30-12-13-37-33(40-30)38-26-8-4-9-27(23-26)47-18-5-14-43-15-19-46-20-16-43/h1-4,6-13,17,21-23H,5,14-16,18-20H2,(H,37,38,40)(H2,39,41,45) |
| InChIKey | GTVNWVRJEUDIMQ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.77 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|