C36H36N8O3S — CID 67005969
1-(2-methylphenyl)-3-[3-[5-[2-[3-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]urea (PubChem CID 67005969) has the molecular formula C36H36N8O3S and a molecular weight of 660.80 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[3-[5-[2-[3-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]urea.
| Compound Name | 1-(2-methylphenyl)-3-[3-[5-[2-[3-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]urea |
|---|---|
| PubChem CID | 67005969 |
| Molecular Formula | C36H36N8O3S |
| Molecular Weight | 660.80 g/mol |
| Exact Mass | 660.26 |
| IUPAC Name | 1-(2-methylphenyl)-3-[3-[5-[2-[3-(3-morpholin-4-ylpropoxy)anilino]pyrimidin-4-yl]imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]urea |
| SMILES | Cc1ccccc1NC(=O)Nc1cccc(-c2nc3sccn3c2-c2ccnc(Nc3cccc(OCCCN4CCOCC4)c3)n2)c1 |
| InChI | InChI=1S/C36H36N8O3S/c1-25-7-2-3-12-30(25)41-35(45)39-27-9-4-8-26(23-27)32-33(44-18-22-48-36(44)42-32)31-13-14-37-34(40-31)38-28-10-5-11-29(24-28)47-19-6-15-43-16-20-46-21-17-43/h2-5,7-14,18,22-24H,6,15-17,19-21H2,1H3,(H,37,38,40)(H2,39,41,45) |
| InChIKey | VIZRPWJJDVBFFC-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.80 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|