C21H19ClF2O5S — CID 67006175
[10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl] acetate (PubChem CID 67006175) has the molecular formula C21H19ClF2O5S and a molecular weight of 456.89 g/mol. Its IUPAC name is [10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl] acetate.
| Compound Name | [10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl] acetate |
|---|---|
| PubChem CID | 67006175 |
| Molecular Formula | C21H19ClF2O5S |
| Molecular Weight | 456.89 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | [10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl] acetate |
| SMILES | CC(=O)OC1CCC2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OCC2C1 |
| InChI | InChI=1S/C21H19ClF2O5S/c1-12(25)29-15-8-9-21(30(26,27)16-4-2-14(22)3-5-16)13(10-15)11-28-20-18(24)7-6-17(23)19(20)21/h2-7,13,15H,8-11H2,1H3 |
| InChIKey | BCUOHENYGJPTPL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.89 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |