C18H28O4 — CID 67006305
3,6-bis(hept-6-enyl)-1,4-dioxane-2,5-dione (PubChem CID 67006305) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 3,6-bis(hept-6-enyl)-1,4-dioxane-2,5-dione.
| Compound Name | 3,6-bis(hept-6-enyl)-1,4-dioxane-2,5-dione |
|---|---|
| PubChem CID | 67006305 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 3,6-bis(hept-6-enyl)-1,4-dioxane-2,5-dione |
| SMILES | C=CCCCCCC1OC(=O)C(CCCCCC=C)OC1=O |
| InChI | InChI=1S/C18H28O4/c1-3-5-7-9-11-13-15-17(19)22-16(18(20)21-15)14-12-10-8-6-4-2/h3-4,15-16H,1-2,5-14H2 |
| InChIKey | NTOWVSOYXXRJPM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|