C14H16N2 — CID 67006366
2-ethyl-4-(1,2,3,6-tetrahydropyridin-4-yl)benzonitrile (PubChem CID 67006366) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 2-ethyl-4-(1,2,3,6-tetrahydropyridin-4-yl)benzonitrile.
| Compound Name | 2-ethyl-4-(1,2,3,6-tetrahydropyridin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 67006366 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2-ethyl-4-(1,2,3,6-tetrahydropyridin-4-yl)benzonitrile |
| SMILES | CCc1cc(C2=CCNCC2)ccc1C#N |
| InChI | InChI=1S/C14H16N2/c1-2-11-9-13(3-4-14(11)10-15)12-5-7-16-8-6-12/h3-5,9,16H,2,6-8H2,1H3 |
| InChIKey | IKXZGGKOGZSDAQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |