C25H33ClF2O5SSi — CID 67006376
tert-butyl-[3-[[(4R)-4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]oxy]butoxy]-dimethylsilane (PubChem CID 67006376) has the molecular formula C25H33ClF2O5SSi and a molecular weight of 547.14 g/mol. Its IUPAC name is tert-butyl-[3-[[(4R)-4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]oxy]butoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-[[(4R)-4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]oxy]butoxy]-dimethylsilane |
|---|---|
| PubChem CID | 67006376 |
| Molecular Formula | C25H33ClF2O5SSi |
| Molecular Weight | 547.14 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | tert-butyl-[3-[[(4R)-4-(4-chlorophenyl)sulfonyl-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]oxy]butoxy]-dimethylsilane |
| SMILES | CC(CCO[Si](C)(C)C(C)(C)C)OC1COc2c(F)ccc(F)c2[C@H]1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H33ClF2O5SSi/c1-16(13-14-32-35(5,6)25(2,3)4)33-21-15-31-23-20(28)12-11-19(27)22(23)24(21)34(29,30)18-9-7-17(26)8-10-18/h7-12,16,21,24H,13-15H2,1-6H3/t16?,21?,24-/m0/s1 |
| InChIKey | NDVYLUDAIZIRGO-NXWRJRFDSA-N |
| XLogP | 6.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.14 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|