C18H16ClF2NO3S — CID 67006405
10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-1,2,3,4,4a,5-hexahydrochromeno[3,4-b]pyridine (PubChem CID 67006405) has the molecular formula C18H16ClF2NO3S and a molecular weight of 399.85 g/mol. Its IUPAC name is 10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-1,2,3,4,4a,5-hexahydrochromeno[3,4-b]pyridine.
| Compound Name | 10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-1,2,3,4,4a,5-hexahydrochromeno[3,4-b]pyridine |
|---|---|
| PubChem CID | 67006405 |
| Molecular Formula | C18H16ClF2NO3S |
| Molecular Weight | 399.85 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-1,2,3,4,4a,5-hexahydrochromeno[3,4-b]pyridine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)C12CCCNC1COc1c(F)ccc(F)c12 |
| InChI | InChI=1S/C18H16ClF2NO3S/c19-11-2-4-12(5-3-11)26(23,24)18-8-1-9-22-15(18)10-25-17-14(21)7-6-13(20)16(17)18/h2-7,15,22H,1,8-10H2 |
| InChIKey | NNBDXZJGOPRHDA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.85 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |