C12H15NO — CID 67006471
2,3,4,4a,5,6a-hexahydro-1H-chromeno[3,4-b]pyridine (PubChem CID 67006471) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 2,3,4,4a,5,6a-hexahydro-1H-chromeno[3,4-b]pyridine.
| Compound Name | 2,3,4,4a,5,6a-hexahydro-1H-chromeno[3,4-b]pyridine |
|---|---|
| PubChem CID | 67006471 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2,3,4,4a,5,6a-hexahydro-1H-chromeno[3,4-b]pyridine |
| SMILES | C1=CC2=C3CCCNC3COC2C=C1 |
| InChI | InChI=1S/C12H15NO/c1-2-6-12-10(4-1)9-5-3-7-13-11(9)8-14-12/h1-2,4,6,11-13H,3,5,7-8H2 |
| InChIKey | XAUCUJUODZIVPW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |