C20H35N3O6Si — CID 67006499
1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-(dimethylamino)pyrimidine-2,4-dione (PubChem CID 67006499) has the molecular formula C20H35N3O6Si and a molecular weight of 441.60 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-(dimethylamino)pyrimidine-2,4-dione.
| Compound Name | 1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-(dimethylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67006499 |
| Molecular Formula | C20H35N3O6Si |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 1-[(3aR,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-(dimethylamino)pyrimidine-2,4-dione |
| SMILES | CN(C)c1cc(=O)[nH]c(=O)n1[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C20H35N3O6Si/c1-19(2,3)30(8,9)26-11-12-15-16(29-20(4,5)28-15)17(27-12)23-14(22(6)7)10-13(24)21-18(23)25/h10,12,15-17H,11H2,1-9H3,(H,21,24,25)/t12-,15-,16-,17-/m1/s1 |
| InChIKey | NQMZQCKCGFQGMM-BASLNEPJSA-N |
| XLogP | 2.04 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|