C26H22FN3O3 — CID 67006589
2-(2-fluoro-5-hydroxyphenyl)-5,5-dimethyl-2-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexane-1,3-dione (PubChem CID 67006589) has the molecular formula C26H22FN3O3 and a molecular weight of 443.48 g/mol. Its IUPAC name is 2-(2-fluoro-5-hydroxyphenyl)-5,5-dimethyl-2-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexane-1,3-dione.
| Compound Name | 2-(2-fluoro-5-hydroxyphenyl)-5,5-dimethyl-2-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 67006589 |
| Molecular Formula | C26H22FN3O3 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 2-(2-fluoro-5-hydroxyphenyl)-5,5-dimethyl-2-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(c2cc(O)ccc2F)(c2c[nH]c3ncc(-c4cccnc4)cc23)C(=O)C1 |
| InChI | InChI=1S/C26H22FN3O3/c1-25(2)10-22(32)26(23(33)11-25,19-9-17(31)5-6-21(19)27)20-14-30-24-18(20)8-16(13-29-24)15-4-3-7-28-12-15/h3-9,12-14,31H,10-11H2,1-2H3,(H,29,30) |
| InChIKey | RYZJZBIEKUWIDR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|