About 8-(2,2,2-trifluoroethyl)-1,4-dioxa-8-azaspiro[4.5]decane
8-(2,2,2-trifluoroethyl)-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 67007162) has the molecular formula C9H14F3NO2
and a molecular weight of 225.21 g/mol. Its IUPAC name is 8-(2,2,2-trifluoroethyl)-1,4-dioxa-8-azaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-(2,2,2-trifluoroethyl)-1,4-dioxa-8-azaspiro[4.5]decane |
| PubChem CID | 67007162 |
| Molecular Formula | C9H14F3NO2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 8-(2,2,2-trifluoroethyl)-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | FC(F)(F)CN1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C9H14F3NO2/c10-9(11,12)7-13-3-1-8(2-4-13)14-5-6-15-8/h1-7H2 |
| InChIKey | HNIHCKHQRCLHDZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-(2,2,2-trifluoroethyl)-1,4-dioxa-8-azaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,2,2-trifluoroethyl)-1,4-dioxa-8-azaspiro[4.5]decane?
The IUPAC name of 8-(2,2,2-trifluoroethyl)-1,4-dioxa-8-azaspiro[4.5]decane (CID 67007162) is 8-(2,2,2-trifluoroethyl)-1,4-dioxa-8-azaspiro[4.5]decane.
What is the SMILES notation for 8-(2,2,2-trifluoroethyl)-1,4-dioxa-8-azaspiro[4.5]decane?
The canonical SMILES for 8-(2,2,2-trifluoroethyl)-1,4-dioxa-8-azaspiro[4.5]decane is FC(F)(F)CN1CCC2(CC1)OCCO2.
What is the InChIKey of 8-(2,2,2-trifluoroethyl)-1,4-dioxa-8-azaspiro[4.5]decane?
The InChIKey is HNIHCKHQRCLHDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO2/c10-9(11,12)7-13-3-1-8(2-4-13)14-5-6-15-8/h1-7H2.
What are the key properties of 8-(2,2,2-trifluoroethyl)-1,4-dioxa-8-azaspiro[4.5]decane?
8-(2,2,2-trifluoroethyl)-1,4-dioxa-8-azaspiro[4.5]decane has a molecular weight of 225.21 g/mol, XLogP of 1.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,2,2-trifluoroethyl)-1,4-dioxa-8-azaspiro[4.5]decane is sourced from PubChem (CID 67007162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).