About 6-bromoimidazo[1,2-a]pyridin-8-ol;hydrochloride
6-bromoimidazo[1,2-a]pyridin-8-ol;hydrochloride (PubChem CID 67007539) has the molecular formula C7H6BrClN2O
and a molecular weight of 249.50 g/mol. Its IUPAC name is 6-bromoimidazo[1,2-a]pyridin-8-ol;hydrochloride.
Molecular Properties
| Compound Name | 6-bromoimidazo[1,2-a]pyridin-8-ol;hydrochloride |
| PubChem CID | 67007539 |
| Molecular Formula | C7H6BrClN2O |
| Molecular Weight | 249.50 g/mol |
| Exact Mass | 247.94 |
| IUPAC Name | 6-bromoimidazo[1,2-a]pyridin-8-ol;hydrochloride |
| SMILES | Cl.Oc1cc(Br)cn2ccnc12 |
| InChI | InChI=1S/C7H5BrN2O.ClH/c8-5-3-6(11)7-9-1-2-10(7)4-5;/h1-4,11H;1H |
| InChIKey | ISYUFUVRCYOSBD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromoimidazo[1,2-a]pyridin-8-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromoimidazo[1,2-a]pyridin-8-ol;hydrochloride?
The IUPAC name of 6-bromoimidazo[1,2-a]pyridin-8-ol;hydrochloride (CID 67007539) is 6-bromoimidazo[1,2-a]pyridin-8-ol;hydrochloride.
What is the SMILES notation for 6-bromoimidazo[1,2-a]pyridin-8-ol;hydrochloride?
The canonical SMILES for 6-bromoimidazo[1,2-a]pyridin-8-ol;hydrochloride is Cl.Oc1cc(Br)cn2ccnc12.
What is the InChIKey of 6-bromoimidazo[1,2-a]pyridin-8-ol;hydrochloride?
The InChIKey is ISYUFUVRCYOSBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrN2O.ClH/c8-5-3-6(11)7-9-1-2-10(7)4-5;/h1-4,11H;1H.
What are the key properties of 6-bromoimidazo[1,2-a]pyridin-8-ol;hydrochloride?
6-bromoimidazo[1,2-a]pyridin-8-ol;hydrochloride has a molecular weight of 249.50 g/mol, XLogP of 2.22, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromoimidazo[1,2-a]pyridin-8-ol;hydrochloride is sourced from PubChem (CID 67007539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).