C22H25FN6O — CID 67007656
1-[2-[1-(4-fluorophenyl)ethylamino]-6-(pyrazin-2-ylamino)-4-pyridinyl]piperidin-4-ol (PubChem CID 67007656) has the molecular formula C22H25FN6O and a molecular weight of 408.48 g/mol. Its IUPAC name is 1-[2-[1-(4-fluorophenyl)ethylamino]-6-(pyrazin-2-ylamino)-4-pyridinyl]piperidin-4-ol.
| Compound Name | 1-[2-[1-(4-fluorophenyl)ethylamino]-6-(pyrazin-2-ylamino)-4-pyridinyl]piperidin-4-ol |
|---|---|
| PubChem CID | 67007656 |
| Molecular Formula | C22H25FN6O |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 1-[2-[1-(4-fluorophenyl)ethylamino]-6-(pyrazin-2-ylamino)-4-pyridinyl]piperidin-4-ol |
| SMILES | CC(Nc1cc(N2CCC(O)CC2)cc(Nc2cnccn2)n1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H25FN6O/c1-15(16-2-4-17(23)5-3-16)26-20-12-18(29-10-6-19(30)7-11-29)13-21(27-20)28-22-14-24-8-9-25-22/h2-5,8-9,12-15,19,30H,6-7,10-11H2,1H3,(H2,25,26,27,28) |
| InChIKey | CXQCDZZRVLJCPA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |