C26H32FN7OSi — CID 67008038
3-[1-(4-fluorophenyl)ethyl]-6-N-pyrazin-2-yl-4-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyridine-2,6-diamine (PubChem CID 67008038) has the molecular formula C26H32FN7OSi and a molecular weight of 505.67 g/mol. Its IUPAC name is 3-[1-(4-fluorophenyl)ethyl]-6-N-pyrazin-2-yl-4-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyridine-2,6-diamine.
| Compound Name | 3-[1-(4-fluorophenyl)ethyl]-6-N-pyrazin-2-yl-4-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 67008038 |
| Molecular Formula | C26H32FN7OSi |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 3-[1-(4-fluorophenyl)ethyl]-6-N-pyrazin-2-yl-4-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyridine-2,6-diamine |
| SMILES | CC(c1ccc(F)cc1)c1c(-c2cnn(COCC[Si](C)(C)C)c2)cc(Nc2cnccn2)nc1N |
| InChI | InChI=1S/C26H32FN7OSi/c1-18(19-5-7-21(27)8-6-19)25-22(13-23(33-26(25)28)32-24-15-29-9-10-30-24)20-14-31-34(16-20)17-35-11-12-36(2,3)4/h5-10,13-16,18H,11-12,17H2,1-4H3,(H3,28,30,32,33) |
| InChIKey | DINSAGPLJIVAKV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|