C27H29ClF2N6O2 — CID 67008168
3-[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b][1,4]diazepin-3-yl]-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 67008168) has the molecular formula C27H29ClF2N6O2 and a molecular weight of 543.02 g/mol. Its IUPAC name is 3-[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b][1,4]diazepin-3-yl]-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 3-[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b][1,4]diazepin-3-yl]-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 67008168 |
| Molecular Formula | C27H29ClF2N6O2 |
| Molecular Weight | 543.02 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 3-[5-[(2-chloro-3,6-difluorophenyl)methyl]-6,7,8,9-tetrahydropyrazino[2,3-b][1,4]diazepin-3-yl]-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | O=C(NCCN1CCOCC1)c1cccc(-c2cnc3c(n2)N(Cc2c(F)ccc(F)c2Cl)CCCN3)c1 |
| InChI | InChI=1S/C27H29ClF2N6O2/c28-24-20(21(29)5-6-22(24)30)17-36-9-2-7-31-25-26(36)34-23(16-33-25)18-3-1-4-19(15-18)27(37)32-8-10-35-11-13-38-14-12-35/h1,3-6,15-16H,2,7-14,17H2,(H,31,33)(H,32,37) |
| InChIKey | IGQNWVGTAOXGRH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.02 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|