C23H29N5O3Si — CID 67008181
2-(3-cyanophenoxy)-N-propyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 67008181) has the molecular formula C23H29N5O3Si and a molecular weight of 451.60 g/mol. Its IUPAC name is 2-(3-cyanophenoxy)-N-propyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-(3-cyanophenoxy)-N-propyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 67008181 |
| Molecular Formula | C23H29N5O3Si |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 2-(3-cyanophenoxy)-N-propyl-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CCCNC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(Oc3cccc(C#N)c3)nc12 |
| InChI | InChI=1S/C23H29N5O3Si/c1-5-9-25-23(29)19-15-28(16-30-10-11-32(2,3)4)22-21(19)27-20(14-26-22)31-18-8-6-7-17(12-18)13-24/h6-8,12,14-15H,5,9-11,16H2,1-4H3,(H,25,29) |
| InChIKey | ULVLKXQNWWLYSG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|