About 1-ethoxy-N,N-dimethyl-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine
1-ethoxy-N,N-dimethyl-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine (PubChem CID 67011254) has the molecular formula C14H25N3O
and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-ethoxy-N,N-dimethyl-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 1-ethoxy-N,N-dimethyl-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 67011254 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 1-ethoxy-N,N-dimethyl-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine |
| SMILES | CCOC1(N(C)C)C=CC(N2CCNCC2)=CC1 |
| InChI | InChI=1S/C14H25N3O/c1-4-18-14(16(2)3)7-5-13(6-8-14)17-11-9-15-10-12-17/h5-7,15H,4,8-12H2,1-3H3 |
| InChIKey | JOPVWOSAQDKQJQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-N,N-dimethyl-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-N,N-dimethyl-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine?
The IUPAC name of 1-ethoxy-N,N-dimethyl-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine (CID 67011254) is 1-ethoxy-N,N-dimethyl-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 1-ethoxy-N,N-dimethyl-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for 1-ethoxy-N,N-dimethyl-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine is CCOC1(N(C)C)C=CC(N2CCNCC2)=CC1.
What is the InChIKey of 1-ethoxy-N,N-dimethyl-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine?
The InChIKey is JOPVWOSAQDKQJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O/c1-4-18-14(16(2)3)7-5-13(6-8-14)17-11-9-15-10-12-17/h5-7,15H,4,8-12H2,1-3H3.
What are the key properties of 1-ethoxy-N,N-dimethyl-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine?
1-ethoxy-N,N-dimethyl-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine has a molecular weight of 251.37 g/mol, XLogP of 1.03, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-N,N-dimethyl-4-piperazin-1-ylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 67011254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).