C19H23N3O2S2 — CID 67011470
2-cyano-3-hydroxy-5,5-dimethyl-N-propan-2-yl-N-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)hex-2-enamide (PubChem CID 67011470) has the molecular formula C19H23N3O2S2 and a molecular weight of 389.55 g/mol. Its IUPAC name is 2-cyano-3-hydroxy-5,5-dimethyl-N-propan-2-yl-N-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)hex-2-enamide.
| Compound Name | 2-cyano-3-hydroxy-5,5-dimethyl-N-propan-2-yl-N-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)hex-2-enamide |
|---|---|
| PubChem CID | 67011470 |
| Molecular Formula | C19H23N3O2S2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2-cyano-3-hydroxy-5,5-dimethyl-N-propan-2-yl-N-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)hex-2-enamide |
| SMILES | CC(C)N(C(=O)C(C#N)=C(O)CC(C)(C)C)c1ccc2[nH]c(=S)sc2c1 |
| InChI | InChI=1S/C19H23N3O2S2/c1-11(2)22(12-6-7-14-16(8-12)26-18(25)21-14)17(24)13(10-20)15(23)9-19(3,4)5/h6-8,11,23H,9H2,1-5H3,(H,21,25) |
| InChIKey | ZQYCJPAAJRZZFX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|