C20H15ClFN3O3S — CID 67011558
2-[benzenesulfonyl-(7-chloro-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)methyl]-5-fluoro-1,3,4-oxadiazole (PubChem CID 67011558) has the molecular formula C20H15ClFN3O3S and a molecular weight of 431.88 g/mol. Its IUPAC name is 2-[benzenesulfonyl-(7-chloro-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)methyl]-5-fluoro-1,3,4-oxadiazole.
| Compound Name | 2-[benzenesulfonyl-(7-chloro-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)methyl]-5-fluoro-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 67011558 |
| Molecular Formula | C20H15ClFN3O3S |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 2-[benzenesulfonyl-(7-chloro-1,2,3,4-tetrahydrocyclopenta[b]indol-2-yl)methyl]-5-fluoro-1,3,4-oxadiazole |
| SMILES | O=S(=O)(c1ccccc1)C(c1nnc(F)o1)C1Cc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C20H15ClFN3O3S/c21-12-6-7-16-15(10-12)14-8-11(9-17(14)23-16)18(19-24-25-20(22)28-19)29(26,27)13-4-2-1-3-5-13/h1-7,10-11,18,23H,8-9H2 |
| InChIKey | ASHBGBRQOPHXCD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|