C35H35F4N9O — CID 67011751
6,7-difluoro-5-phenyl-1H-indazol-3-amine;1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea (PubChem CID 67011751) has the molecular formula C35H35F4N9O and a molecular weight of 673.72 g/mol. Its IUPAC name is 6,7-difluoro-5-phenyl-1H-indazol-3-amine;1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea.
| Compound Name | 6,7-difluoro-5-phenyl-1H-indazol-3-amine;1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 67011751 |
| Molecular Formula | C35H35F4N9O |
| Molecular Weight | 673.72 g/mol |
| Exact Mass | 673.29 |
| IUPAC Name | 6,7-difluoro-5-phenyl-1H-indazol-3-amine;1-(6,7-difluoro-5-phenyl-1H-indazol-3-yl)-3-[3-(4-methylpiperazin-1-yl)propyl]urea |
| SMILES | CN1CCN(CCCNC(=O)Nc2n[nH]c3c(F)c(F)c(-c4ccccc4)cc23)CC1.Nc1n[nH]c2c(F)c(F)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C22H26F2N6O.C13H9F2N3/c1-29-10-12-30(13-11-29)9-5-8-25-22(31)26-21-17-14-16(15-6-3-2-4-7-15)18(23)19(24)20(17)27-28-21;14-10-8(7-4-2-1-3-5-7)6-9-12(11(10)15)17-18-13(9)16/h2-4,6-7,14H,5,8-13H2,1H3,(H3,25,26,27,28,31);1-6H,(H3,16,17,18) |
| InChIKey | HHQVETCJWQTBRG-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.72 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|