About 2-benzhydrylpiperazine-1,3-dicarboxamide
2-benzhydrylpiperazine-1,3-dicarboxamide (PubChem CID 67012309) has the molecular formula C19H22N4O2
and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-benzhydrylpiperazine-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 2-benzhydrylpiperazine-1,3-dicarboxamide |
| PubChem CID | 67012309 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-benzhydrylpiperazine-1,3-dicarboxamide |
| SMILES | NC(=O)C1NCCN(C(N)=O)C1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N4O2/c20-18(24)16-17(23(19(21)25)12-11-22-16)15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-17,22H,11-12H2,(H2,20,24)(H2,21,25) |
| InChIKey | JKGXQLYJVPGMNO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzhydrylpiperazine-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzhydrylpiperazine-1,3-dicarboxamide?
The IUPAC name of 2-benzhydrylpiperazine-1,3-dicarboxamide (CID 67012309) is 2-benzhydrylpiperazine-1,3-dicarboxamide.
What is the SMILES notation for 2-benzhydrylpiperazine-1,3-dicarboxamide?
The canonical SMILES for 2-benzhydrylpiperazine-1,3-dicarboxamide is NC(=O)C1NCCN(C(N)=O)C1C(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-benzhydrylpiperazine-1,3-dicarboxamide?
The InChIKey is JKGXQLYJVPGMNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O2/c20-18(24)16-17(23(19(21)25)12-11-22-16)15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-17,22H,11-12H2,(H2,20,24)(H2,21,25).
What are the key properties of 2-benzhydrylpiperazine-1,3-dicarboxamide?
2-benzhydrylpiperazine-1,3-dicarboxamide has a molecular weight of 338.41 g/mol, XLogP of 1.02, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzhydrylpiperazine-1,3-dicarboxamide is sourced from PubChem (CID 67012309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).