About 1-N-[(1-ethylpyrrolidin-2-yl)methyl]piperazine-1,3-dicarboxamide
1-N-[(1-ethylpyrrolidin-2-yl)methyl]piperazine-1,3-dicarboxamide (PubChem CID 67012430) has the molecular formula C13H25N5O2
and a molecular weight of 283.38 g/mol. Its IUPAC name is 1-N-[(1-ethylpyrrolidin-2-yl)methyl]piperazine-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 1-N-[(1-ethylpyrrolidin-2-yl)methyl]piperazine-1,3-dicarboxamide |
| PubChem CID | 67012430 |
| Molecular Formula | C13H25N5O2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 1-N-[(1-ethylpyrrolidin-2-yl)methyl]piperazine-1,3-dicarboxamide |
| SMILES | CCN1CCCC1CNC(=O)N1CCNC(C(N)=O)C1 |
| InChI | InChI=1S/C13H25N5O2/c1-2-17-6-3-4-10(17)8-16-13(20)18-7-5-15-11(9-18)12(14)19/h10-11,15H,2-9H2,1H3,(H2,14,19)(H,16,20) |
| InChIKey | SHZDEDJXLOMFMO-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N-[(1-ethylpyrrolidin-2-yl)methyl]piperazine-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[(1-ethylpyrrolidin-2-yl)methyl]piperazine-1,3-dicarboxamide?
The IUPAC name of 1-N-[(1-ethylpyrrolidin-2-yl)methyl]piperazine-1,3-dicarboxamide (CID 67012430) is 1-N-[(1-ethylpyrrolidin-2-yl)methyl]piperazine-1,3-dicarboxamide.
What is the SMILES notation for 1-N-[(1-ethylpyrrolidin-2-yl)methyl]piperazine-1,3-dicarboxamide?
The canonical SMILES for 1-N-[(1-ethylpyrrolidin-2-yl)methyl]piperazine-1,3-dicarboxamide is CCN1CCCC1CNC(=O)N1CCNC(C(N)=O)C1.
What is the InChIKey of 1-N-[(1-ethylpyrrolidin-2-yl)methyl]piperazine-1,3-dicarboxamide?
The InChIKey is SHZDEDJXLOMFMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N5O2/c1-2-17-6-3-4-10(17)8-16-13(20)18-7-5-15-11(9-18)12(14)19/h10-11,15H,2-9H2,1H3,(H2,14,19)(H,16,20).
What are the key properties of 1-N-[(1-ethylpyrrolidin-2-yl)methyl]piperazine-1,3-dicarboxamide?
1-N-[(1-ethylpyrrolidin-2-yl)methyl]piperazine-1,3-dicarboxamide has a molecular weight of 283.38 g/mol, XLogP of -1.06, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[(1-ethylpyrrolidin-2-yl)methyl]piperazine-1,3-dicarboxamide is sourced from PubChem (CID 67012430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).