C24H19FN4O — CID 67012538
6-[2-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]pyridine-2-carboxamide (PubChem CID 67012538) has the molecular formula C24H19FN4O and a molecular weight of 398.44 g/mol. Its IUPAC name is 6-[2-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]pyridine-2-carboxamide.
| Compound Name | 6-[2-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 67012538 |
| Molecular Formula | C24H19FN4O |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 6-[2-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cccc(CC(c2ccc(F)cc2)(c2cccnc2)c2cccnc2)n1 |
| InChI | InChI=1S/C24H19FN4O/c25-20-10-8-17(9-11-20)24(18-4-2-12-27-15-18,19-5-3-13-28-16-19)14-21-6-1-7-22(29-21)23(26)30/h1-13,15-16H,14H2,(H2,26,30) |
| InChIKey | AQVBITWCCGTPSW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |