C20H31F2N5O2 — CID 67012661
7-[(3R,4R)-3-[(1R)-1-amino-3-methoxypropyl]-4-fluoropyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-2,4-dihydroquinazolin-3-amine (PubChem CID 67012661) has the molecular formula C20H31F2N5O2 and a molecular weight of 411.50 g/mol. Its IUPAC name is 7-[(3R,4R)-3-[(1R)-1-amino-3-methoxypropyl]-4-fluoropyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-2,4-dihydroquinazolin-3-amine.
| Compound Name | 7-[(3R,4R)-3-[(1R)-1-amino-3-methoxypropyl]-4-fluoropyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-2,4-dihydroquinazolin-3-amine |
|---|---|
| PubChem CID | 67012661 |
| Molecular Formula | C20H31F2N5O2 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 7-[(3R,4R)-3-[(1R)-1-amino-3-methoxypropyl]-4-fluoropyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-2,4-dihydroquinazolin-3-amine |
| SMILES | COCC[C@@H](N)[C@H]1CN(c2c(F)cc3c(c2OC)N(C2CC2)CN(N)C3)C[C@@H]1F |
| InChI | InChI=1S/C20H31F2N5O2/c1-28-6-5-17(23)14-9-25(10-16(14)22)19-15(21)7-12-8-26(24)11-27(13-3-4-13)18(12)20(19)29-2/h7,13-14,16-17H,3-6,8-11,23-24H2,1-2H3/t14-,16-,17+/m0/s1 |
| InChIKey | XADLLZQMQCRWNR-BHYGNILZSA-N |
| XLogP | 1.59 |
| TPSA | 80.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|