C23H26ClN3O3S — CID 67013111
N-[(3R,4S)-1-[2-[2-(4-chlorophenyl)sulfanylethoxy]phenyl]-4-hydroxypentan-3-yl]-1H-imidazole-5-carboxamide (PubChem CID 67013111) has the molecular formula C23H26ClN3O3S and a molecular weight of 460.00 g/mol. Its IUPAC name is N-[(3R,4S)-1-[2-[2-(4-chlorophenyl)sulfanylethoxy]phenyl]-4-hydroxypentan-3-yl]-1H-imidazole-5-carboxamide.
| Compound Name | N-[(3R,4S)-1-[2-[2-(4-chlorophenyl)sulfanylethoxy]phenyl]-4-hydroxypentan-3-yl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 67013111 |
| Molecular Formula | C23H26ClN3O3S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-[(3R,4S)-1-[2-[2-(4-chlorophenyl)sulfanylethoxy]phenyl]-4-hydroxypentan-3-yl]-1H-imidazole-5-carboxamide |
| SMILES | C[C@H](O)[C@@H](CCc1ccccc1OCCSc1ccc(Cl)cc1)NC(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C23H26ClN3O3S/c1-16(28)20(27-23(29)21-14-25-15-26-21)11-6-17-4-2-3-5-22(17)30-12-13-31-19-9-7-18(24)8-10-19/h2-5,7-10,14-16,20,28H,6,11-13H2,1H3,(H,25,26)(H,27,29)/t16-,20+/m0/s1 |
| InChIKey | OKLWBLBQVRIKRG-OXJNMPFZSA-N |
| XLogP | 4.35 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|