C24H28FN5O4 — CID 67013357
3-amino-7-[(3R,4S)-3-[(2S)-2-amino-2-phenoxyethyl]-4-fluoropyrrolidin-1-yl]-1-cyclopropyl-8-methoxyquinazoline-2,4-dione (PubChem CID 67013357) has the molecular formula C24H28FN5O4 and a molecular weight of 469.52 g/mol. Its IUPAC name is 3-amino-7-[(3R,4S)-3-[(2S)-2-amino-2-phenoxyethyl]-4-fluoropyrrolidin-1-yl]-1-cyclopropyl-8-methoxyquinazoline-2,4-dione.
| Compound Name | 3-amino-7-[(3R,4S)-3-[(2S)-2-amino-2-phenoxyethyl]-4-fluoropyrrolidin-1-yl]-1-cyclopropyl-8-methoxyquinazoline-2,4-dione |
|---|---|
| PubChem CID | 67013357 |
| Molecular Formula | C24H28FN5O4 |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 3-amino-7-[(3R,4S)-3-[(2S)-2-amino-2-phenoxyethyl]-4-fluoropyrrolidin-1-yl]-1-cyclopropyl-8-methoxyquinazoline-2,4-dione |
| SMILES | COc1c(N2C[C@@H](C[C@@H](N)Oc3ccccc3)[C@H](F)C2)ccc2c(=O)n(N)c(=O)n(C3CC3)c12 |
| InChI | InChI=1S/C24H28FN5O4/c1-33-22-19(10-9-17-21(22)29(15-7-8-15)24(32)30(27)23(17)31)28-12-14(18(25)13-28)11-20(26)34-16-5-3-2-4-6-16/h2-6,9-10,14-15,18,20H,7-8,11-13,26-27H2,1H3/t14-,18-,20+/m1/s1 |
| InChIKey | DJWVSQJBPFMBOV-DJKXOVBDSA-N |
| XLogP | 1.75 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|