C30H39N5O2 — CID 67013505
1-[4-[4-[4-(cyclohexylamino)piperidin-1-yl]piperazine-1-carbonyl]phenyl]-3-pyridin-2-ylprop-2-en-1-one (PubChem CID 67013505) has the molecular formula C30H39N5O2 and a molecular weight of 501.68 g/mol. Its IUPAC name is 1-[4-[4-[4-(cyclohexylamino)piperidin-1-yl]piperazine-1-carbonyl]phenyl]-3-pyridin-2-ylprop-2-en-1-one.
| Compound Name | 1-[4-[4-[4-(cyclohexylamino)piperidin-1-yl]piperazine-1-carbonyl]phenyl]-3-pyridin-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 67013505 |
| Molecular Formula | C30H39N5O2 |
| Molecular Weight | 501.68 g/mol |
| Exact Mass | 501.31 |
| IUPAC Name | 1-[4-[4-[4-(cyclohexylamino)piperidin-1-yl]piperazine-1-carbonyl]phenyl]-3-pyridin-2-ylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccccn1)c1ccc(C(=O)N2CCN(N3CCC(NC4CCCCC4)CC3)CC2)cc1 |
| InChI | InChI=1S/C30H39N5O2/c36-29(14-13-26-6-4-5-17-31-26)24-9-11-25(12-10-24)30(37)33-20-22-35(23-21-33)34-18-15-28(16-19-34)32-27-7-2-1-3-8-27/h4-6,9-14,17,27-28,32H,1-3,7-8,15-16,18-23H2 |
| InChIKey | JUXJXECWFPTFAQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.68 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|